C8H5F7N2O2 — CID 146231679
4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrimidin-6-one (PubChem CID 146231679) has the molecular formula C8H5F7N2O2 and a molecular weight of 294.13 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146231679 |
| Molecular Formula | C8H5F7N2O2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)(F)C(F)(F)C(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C8H5F7N2O2/c9-6(10,7(11,12)8(13,14)15)2-19-5-1-4(18)16-3-17-5/h1,3H,2H2,(H,16,17,18) |
| InChIKey | GCFWBVPLHDOYNQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|