C8H6F6N2O2 — CID 146231682
4-(2,2,3,4,4,4-hexafluorobutoxy)-1H-pyrimidin-6-one (PubChem CID 146231682) has the molecular formula C8H6F6N2O2 and a molecular weight of 276.14 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146231682 |
| Molecular Formula | C8H6F6N2O2 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)(F)C(F)C(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C8H6F6N2O2/c9-6(8(12,13)14)7(10,11)2-18-5-1-4(17)15-3-16-5/h1,3,6H,2H2,(H,15,16,17) |
| InChIKey | INLMLWJTGAVWSB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |