C17H24N2 — CID 146231987
(2E)-1-N'-butyl-2-[(6Z)-6-prop-2-enylidenecyclohexa-2,4-dien-1-ylidene]but-3-ene-1,1-diamine (PubChem CID 146231987) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2E)-1-N'-butyl-2-[(6Z)-6-prop-2-enylidenecyclohexa-2,4-dien-1-ylidene]but-3-ene-1,1-diamine.
| Compound Name | (2E)-1-N'-butyl-2-[(6Z)-6-prop-2-enylidenecyclohexa-2,4-dien-1-ylidene]but-3-ene-1,1-diamine |
|---|---|
| PubChem CID | 146231987 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (2E)-1-N'-butyl-2-[(6Z)-6-prop-2-enylidenecyclohexa-2,4-dien-1-ylidene]but-3-ene-1,1-diamine |
| SMILES | C=C/C=c1/cccc/c1=C(/C=C)C(N)NCCCC |
| InChI | InChI=1S/C17H24N2/c1-4-7-13-19-17(18)15(6-3)16-12-9-8-11-14(16)10-5-2/h5-6,8-12,17,19H,2-4,7,13,18H2,1H3/b14-10-,16-15+ |
| InChIKey | WINBYWZBLLOMOT-LNQZIOOASA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|