C17H21I3O10 — CID 146232066
(2,3,4,5,6,7,8-heptahydroxycyclononyl) (2,3,5-triiodophenyl)methyl carbonate (PubChem CID 146232066) has the molecular formula C17H21I3O10 and a molecular weight of 766.06 g/mol. Its IUPAC name is (2,3,4,5,6,7,8-heptahydroxycyclononyl) (2,3,5-triiodophenyl)methyl carbonate.
| Compound Name | (2,3,4,5,6,7,8-heptahydroxycyclononyl) (2,3,5-triiodophenyl)methyl carbonate |
|---|---|
| PubChem CID | 146232066 |
| Molecular Formula | C17H21I3O10 |
| Molecular Weight | 766.06 g/mol |
| Exact Mass | 765.83 |
| IUPAC Name | (2,3,4,5,6,7,8-heptahydroxycyclononyl) (2,3,5-triiodophenyl)methyl carbonate |
| SMILES | O=C(OCc1cc(I)cc(I)c1I)OC1CC(O)C(O)C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C17H21I3O10/c18-6-1-5(10(20)7(19)2-6)4-29-17(28)30-9-3-8(21)11(22)13(24)15(26)16(27)14(25)12(9)23/h1-2,8-9,11-16,21-27H,3-4H2 |
| InChIKey | WRNQMCHXRLLBLD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.06 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|