About 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one
1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one (PubChem CID 146232258) has the molecular formula C7H6F3NOS
and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one |
| PubChem CID | 146232258 |
| Molecular Formula | C7H6F3NOS |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one |
| SMILES | CCC(=O)c1csc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F3NOS/c1-2-5(12)4-3-13-6(11-4)7(8,9)10/h3H,2H2,1H3 |
| InChIKey | AITSQOZSQULHOX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one?
The IUPAC name of 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one (CID 146232258) is 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one.
What is the SMILES notation for 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one?
The canonical SMILES for 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one is CCC(=O)c1csc(C(F)(F)F)n1.
What is the InChIKey of 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one?
The InChIKey is AITSQOZSQULHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NOS/c1-2-5(12)4-3-13-6(11-4)7(8,9)10/h3H,2H2,1H3.
What are the key properties of 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one?
1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one has a molecular weight of 209.19 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-1-one is sourced from PubChem (CID 146232258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).