About 4-(2-butyloctyl)-1,3-dioxol-2-one
4-(2-butyloctyl)-1,3-dioxol-2-one (PubChem CID 146232791) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-(2-butyloctyl)-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | 4-(2-butyloctyl)-1,3-dioxol-2-one |
| PubChem CID | 146232791 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-(2-butyloctyl)-1,3-dioxol-2-one |
| SMILES | CCCCCCC(CCCC)Cc1coc(=O)o1 |
| InChI | InChI=1S/C15H26O3/c1-3-5-7-8-10-13(9-6-4-2)11-14-12-17-15(16)18-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | RNGNMOKUUJYZEL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-butyloctyl)-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butyloctyl)-1,3-dioxol-2-one?
The IUPAC name of 4-(2-butyloctyl)-1,3-dioxol-2-one (CID 146232791) is 4-(2-butyloctyl)-1,3-dioxol-2-one.
What is the SMILES notation for 4-(2-butyloctyl)-1,3-dioxol-2-one?
The canonical SMILES for 4-(2-butyloctyl)-1,3-dioxol-2-one is CCCCCCC(CCCC)Cc1coc(=O)o1.
What is the InChIKey of 4-(2-butyloctyl)-1,3-dioxol-2-one?
The InChIKey is RNGNMOKUUJYZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-3-5-7-8-10-13(9-6-4-2)11-14-12-17-15(16)18-14/h12-13H,3-11H2,1-2H3.
What are the key properties of 4-(2-butyloctyl)-1,3-dioxol-2-one?
4-(2-butyloctyl)-1,3-dioxol-2-one has a molecular weight of 254.37 g/mol, XLogP of 4.55, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butyloctyl)-1,3-dioxol-2-one is sourced from PubChem (CID 146232791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).