About 4-fluoro-2,3-dihydronaphthalen-2-amine
4-fluoro-2,3-dihydronaphthalen-2-amine (PubChem CID 146232935) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 4-fluoro-2,3-dihydronaphthalen-2-amine.
Molecular Properties
| Compound Name | 4-fluoro-2,3-dihydronaphthalen-2-amine |
| PubChem CID | 146232935 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 4-fluoro-2,3-dihydronaphthalen-2-amine |
| SMILES | NC1C=c2ccccc2=C(F)C1 |
| InChI | InChI=1S/C10H10FN/c11-10-6-8(12)5-7-3-1-2-4-9(7)10/h1-5,8H,6,12H2 |
| InChIKey | ZLIPKQXSHYVMIJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,3-dihydronaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3-dihydronaphthalen-2-amine?
The IUPAC name of 4-fluoro-2,3-dihydronaphthalen-2-amine (CID 146232935) is 4-fluoro-2,3-dihydronaphthalen-2-amine.
What is the SMILES notation for 4-fluoro-2,3-dihydronaphthalen-2-amine?
The canonical SMILES for 4-fluoro-2,3-dihydronaphthalen-2-amine is NC1C=c2ccccc2=C(F)C1.
What is the InChIKey of 4-fluoro-2,3-dihydronaphthalen-2-amine?
The InChIKey is ZLIPKQXSHYVMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c11-10-6-8(12)5-7-3-1-2-4-9(7)10/h1-5,8H,6,12H2.
What are the key properties of 4-fluoro-2,3-dihydronaphthalen-2-amine?
4-fluoro-2,3-dihydronaphthalen-2-amine has a molecular weight of 163.19 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dihydronaphthalen-2-amine is sourced from PubChem (CID 146232935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).