About 5-fluoro-3-methyl-1,2-dihydronaphthalene
5-fluoro-3-methyl-1,2-dihydronaphthalene (PubChem CID 146233023) has the molecular formula C11H11F
and a molecular weight of 162.21 g/mol. Its IUPAC name is 5-fluoro-3-methyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-1,2-dihydronaphthalene |
| PubChem CID | 146233023 |
| Molecular Formula | C11H11F |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-fluoro-3-methyl-1,2-dihydronaphthalene |
| SMILES | CC1=Cc2c(F)cccc2CC1 |
| InChI | InChI=1S/C11H11F/c1-8-5-6-9-3-2-4-11(12)10(9)7-8/h2-4,7H,5-6H2,1H3 |
| InChIKey | BXJCSPORKRHHFW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-3-methyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-1,2-dihydronaphthalene?
The IUPAC name of 5-fluoro-3-methyl-1,2-dihydronaphthalene (CID 146233023) is 5-fluoro-3-methyl-1,2-dihydronaphthalene.
What is the SMILES notation for 5-fluoro-3-methyl-1,2-dihydronaphthalene?
The canonical SMILES for 5-fluoro-3-methyl-1,2-dihydronaphthalene is CC1=Cc2c(F)cccc2CC1.
What is the InChIKey of 5-fluoro-3-methyl-1,2-dihydronaphthalene?
The InChIKey is BXJCSPORKRHHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F/c1-8-5-6-9-3-2-4-11(12)10(9)7-8/h2-4,7H,5-6H2,1H3.
What are the key properties of 5-fluoro-3-methyl-1,2-dihydronaphthalene?
5-fluoro-3-methyl-1,2-dihydronaphthalene has a molecular weight of 162.21 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-1,2-dihydronaphthalene is sourced from PubChem (CID 146233023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).