C19H31NO4 — CID 146233292
(3Z,5Z)-5,6-dimethoxy-3-[(E)-2-methoxyprop-1-enyl]-1-(2-methylpiperidin-1-yl)hepta-3,5-dien-1-one (PubChem CID 146233292) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is (3Z,5Z)-5,6-dimethoxy-3-[(E)-2-methoxyprop-1-enyl]-1-(2-methylpiperidin-1-yl)hepta-3,5-dien-1-one.
| Compound Name | (3Z,5Z)-5,6-dimethoxy-3-[(E)-2-methoxyprop-1-enyl]-1-(2-methylpiperidin-1-yl)hepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 146233292 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (3Z,5Z)-5,6-dimethoxy-3-[(E)-2-methoxyprop-1-enyl]-1-(2-methylpiperidin-1-yl)hepta-3,5-dien-1-one |
| SMILES | CO/C(C)=C(/C=C(\C=C(/C)OC)CC(=O)N1CCCCC1C)OC |
| InChI | InChI=1S/C19H31NO4/c1-14-9-7-8-10-20(14)19(21)13-17(11-15(2)22-4)12-18(24-6)16(3)23-5/h11-12,14H,7-10,13H2,1-6H3/b15-11+,17-12+,18-16- |
| InChIKey | WSBNDTGXLRMIEV-PJJCKRMZSA-N |
| XLogP | 3.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|