C31H40N4O5S — CID 146233344
(3R)-5-(1-cyclobutyltriazol-4-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpentanoic acid (PubChem CID 146233344) has the molecular formula C31H40N4O5S and a molecular weight of 580.75 g/mol. Its IUPAC name is (3R)-5-(1-cyclobutyltriazol-4-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpentanoic acid.
| Compound Name | (3R)-5-(1-cyclobutyltriazol-4-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 146233344 |
| Molecular Formula | C31H40N4O5S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | (3R)-5-(1-cyclobutyltriazol-4-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpentanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc([C@@H](CCc3cn(C4CCC4)nn3)C(C)(C)C(=O)O)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C31H40N4O5S/c1-5-26-20-34(41(38,39)29-12-7-6-11-28(29)40-26)18-23-17-22(14-13-21(23)2)27(31(3,4)30(36)37)16-15-24-19-35(33-32-24)25-9-8-10-25/h6-7,11-14,17,19,25-27H,5,8-10,15-16,18,20H2,1-4H3,(H,36,37)/t26-,27-/m1/s1 |
| InChIKey | PPDPFKKZJGMKMG-KAYWLYCHSA-N |
| XLogP | 5.50 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |