C22H26N6O2 — CID 146233856
4-(1H-indazol-4-yl)-10,10-dimethyl-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 146233856) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-(1H-indazol-4-yl)-10,10-dimethyl-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | 4-(1H-indazol-4-yl)-10,10-dimethyl-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 146233856 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-(1H-indazol-4-yl)-10,10-dimethyl-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | CC1(C)OCCN2c3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3CC21 |
| InChI | InChI=1S/C22H26N6O2/c1-22(2)18-12-15-20(27-6-9-29-10-7-27)24-19(25-21(15)28(18)8-11-30-22)14-4-3-5-17-16(14)13-23-26-17/h3-5,13,18H,6-12H2,1-2H3,(H,23,26) |
| InChIKey | UYFSVTLNBOPSLL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |