C18H29N — CID 146233876
(E,2E)-4-methyl-N-[(2Z,4Z)-octa-2,4-dienyl]-2-propylidenehex-3-en-1-imine (PubChem CID 146233876) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (E,2E)-4-methyl-N-[(2Z,4Z)-octa-2,4-dienyl]-2-propylidenehex-3-en-1-imine.
| Compound Name | (E,2E)-4-methyl-N-[(2Z,4Z)-octa-2,4-dienyl]-2-propylidenehex-3-en-1-imine |
|---|---|
| PubChem CID | 146233876 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (E,2E)-4-methyl-N-[(2Z,4Z)-octa-2,4-dienyl]-2-propylidenehex-3-en-1-imine |
| SMILES | CC/C=C(/C=N/C/C=C\C=C/CCC)\C=C(/C)CC |
| InChI | InChI=1S/C18H29N/c1-5-8-9-10-11-12-14-19-16-18(13-6-2)15-17(4)7-3/h9-13,15-16H,5-8,14H2,1-4H3/b10-9-,12-11-,17-15+,18-13+,19-16+ |
| InChIKey | OCFKPWCXMAUZGD-IXLGSTFASA-N |
| XLogP | 5.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|