C11H10BrNO2S — CID 146234042
ethyl 4-bromo-2-sulfanylidene-1,3-dihydroindole-6-carboxylate (PubChem CID 146234042) has the molecular formula C11H10BrNO2S and a molecular weight of 300.18 g/mol. Its IUPAC name is ethyl 4-bromo-2-sulfanylidene-1,3-dihydroindole-6-carboxylate.
| Compound Name | ethyl 4-bromo-2-sulfanylidene-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 146234042 |
| Molecular Formula | C11H10BrNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | ethyl 4-bromo-2-sulfanylidene-1,3-dihydroindole-6-carboxylate |
| SMILES | CCOC(=O)c1cc(Br)c2c(c1)NC(=S)C2 |
| InChI | InChI=1S/C11H10BrNO2S/c1-2-15-11(14)6-3-8(12)7-5-10(16)13-9(7)4-6/h3-4H,2,5H2,1H3,(H,13,16) |
| InChIKey | BTTHJONNHFJROF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|