C24H25F3N2OS — CID 146234053
2-[(E)-3-(3-ethenyl-4-ethylcyclohexyl)prop-1-enyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 146234053) has the molecular formula C24H25F3N2OS and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-[(E)-3-(3-ethenyl-4-ethylcyclohexyl)prop-1-enyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 2-[(E)-3-(3-ethenyl-4-ethylcyclohexyl)prop-1-enyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 146234053 |
| Molecular Formula | C24H25F3N2OS |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[(E)-3-(3-ethenyl-4-ethylcyclohexyl)prop-1-enyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | C=CC1CC(C/C=C/c2nc3cc(C(F)(F)F)cc(-c4nccs4)c3o2)CCC1CC |
| InChI | InChI=1S/C24H25F3N2OS/c1-3-16-9-8-15(12-17(16)4-2)6-5-7-21-29-20-14-18(24(25,26)27)13-19(22(20)30-21)23-28-10-11-31-23/h4-5,7,10-11,13-17H,2-3,6,8-9,12H2,1H3/b7-5+ |
| InChIKey | MJZFDVORWIUFHK-FNORWQNLSA-N |
| XLogP | 8.00 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|