C23H23F3N2OS — CID 146234144
2-[2-(6-ethenyl-3-bicyclo[3.2.1]octanyl)ethyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 146234144) has the molecular formula C23H23F3N2OS and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[2-(6-ethenyl-3-bicyclo[3.2.1]octanyl)ethyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 2-[2-(6-ethenyl-3-bicyclo[3.2.1]octanyl)ethyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 146234144 |
| Molecular Formula | C23H23F3N2OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[2-(6-ethenyl-3-bicyclo[3.2.1]octanyl)ethyl]-7-(1,3-thiazol-2-yl)-5-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | C=CC1CC2CC(CCc3nc4cc(C(F)(F)F)cc(-c5nccs5)c4o3)CC1C2 |
| InChI | InChI=1S/C23H23F3N2OS/c1-2-15-9-14-7-13(8-16(15)10-14)3-4-20-28-19-12-17(23(24,25)26)11-18(21(19)29-20)22-27-5-6-30-22/h2,5-6,11-16H,1,3-4,7-10H2 |
| InChIKey | CQIDWVLODYCEMP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|