C32H30ClN3O5 — CID 146234529
[(1R)-1-(benzylamino)-2-phenylethyl] 3-[5-chloro-2-oxo-6-[(1R)-1-pyridin-2-ylethoxy]-1,3-benzoxazol-3-yl]propanoate (PubChem CID 146234529) has the molecular formula C32H30ClN3O5 and a molecular weight of 572.06 g/mol. Its IUPAC name is [(1R)-1-(benzylamino)-2-phenylethyl] 3-[5-chloro-2-oxo-6-[(1R)-1-pyridin-2-ylethoxy]-1,3-benzoxazol-3-yl]propanoate.
| Compound Name | [(1R)-1-(benzylamino)-2-phenylethyl] 3-[5-chloro-2-oxo-6-[(1R)-1-pyridin-2-ylethoxy]-1,3-benzoxazol-3-yl]propanoate |
|---|---|
| PubChem CID | 146234529 |
| Molecular Formula | C32H30ClN3O5 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | [(1R)-1-(benzylamino)-2-phenylethyl] 3-[5-chloro-2-oxo-6-[(1R)-1-pyridin-2-ylethoxy]-1,3-benzoxazol-3-yl]propanoate |
| SMILES | C[C@@H](Oc1cc2oc(=O)n(CCC(=O)OC(Cc3ccccc3)NCc3ccccc3)c2cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C32H30ClN3O5/c1-22(26-14-8-9-16-34-26)39-28-20-29-27(19-25(28)33)36(32(38)40-29)17-15-31(37)41-30(18-23-10-4-2-5-11-23)35-21-24-12-6-3-7-13-24/h2-14,16,19-20,22,30,35H,15,17-18,21H2,1H3/t22-,30?/m1/s1 |
| InChIKey | XEGOGQUNZAULGQ-VWRCBCJMSA-N |
| XLogP | 6.07 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|