C31H30ClFN4O2 — CID 146235154
6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-4-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 146235154) has the molecular formula C31H30ClFN4O2 and a molecular weight of 545.06 g/mol. Its IUPAC name is 6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-4-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-4-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 146235154 |
| Molecular Formula | C31H30ClFN4O2 |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-4-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCC(c2nc(=O)n(-c3c(CC)cccc3CC)c3nc(-c4ccccc4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C31H30ClFN4O2/c1-4-19-10-9-11-20(5-2)29(19)37-30-23(18-24(32)28(34-30)22-12-7-8-13-25(22)33)27(35-31(37)39)21-14-16-36(17-15-21)26(38)6-3/h6-13,18,21H,3-5,14-17H2,1-2H3 |
| InChIKey | VCLQHGGFSIZVND-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|