About (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride
(3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride (PubChem CID 146236610) has the molecular formula C11H12BrClFNO2
and a molecular weight of 324.58 g/mol. Its IUPAC name is (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride.
Molecular Properties
| Compound Name | (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride |
| PubChem CID | 146236610 |
| Molecular Formula | C11H12BrClFNO2 |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride |
| SMILES | Cl.NC1CC(OC(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C11H11BrFNO2.ClH/c12-6-1-2-9(10(13)3-6)11(15)16-8-4-7(14)5-8;/h1-3,7-8H,4-5,14H2;1H |
| InChIKey | OIOYXJZIXRSDLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride?
The IUPAC name of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride (CID 146236610) is (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride.
What is the SMILES notation for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride?
The canonical SMILES for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride is Cl.NC1CC(OC(=O)c2ccc(Br)cc2F)C1.
What is the InChIKey of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride?
The InChIKey is OIOYXJZIXRSDLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO2.ClH/c12-6-1-2-9(10(13)3-6)11(15)16-8-4-7(14)5-8;/h1-3,7-8H,4-5,14H2;1H.
What are the key properties of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride?
(3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride has a molecular weight of 324.58 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate;hydrochloride is sourced from PubChem (CID 146236610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).