About (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate
(3-aminocyclobutyl) 4-bromo-2-fluorobenzoate (PubChem CID 146236611) has the molecular formula C11H11BrFNO2
and a molecular weight of 288.12 g/mol. Its IUPAC name is (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate |
| PubChem CID | 146236611 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate |
| SMILES | NC1CC(OC(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C11H11BrFNO2/c12-6-1-2-9(10(13)3-6)11(15)16-8-4-7(14)5-8/h1-3,7-8H,4-5,14H2 |
| InChIKey | FLYQHBIKDAKNAT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate?
The IUPAC name of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate (CID 146236611) is (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate.
What is the SMILES notation for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate?
The canonical SMILES for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate is NC1CC(OC(=O)c2ccc(Br)cc2F)C1.
What is the InChIKey of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate?
The InChIKey is FLYQHBIKDAKNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO2/c12-6-1-2-9(10(13)3-6)11(15)16-8-4-7(14)5-8/h1-3,7-8H,4-5,14H2.
What are the key properties of (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate?
(3-aminocyclobutyl) 4-bromo-2-fluorobenzoate has a molecular weight of 288.12 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclobutyl) 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 146236611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).