C15H27FN2O — CID 146237710
(2S,3S,5Z,7E)-8-fluoro-1-N-(2-methoxyethyl)-1-N,3-dimethyl-4-methylidenenona-5,7-diene-1,2-diamine (PubChem CID 146237710) has the molecular formula C15H27FN2O and a molecular weight of 270.39 g/mol. Its IUPAC name is (2S,3S,5Z,7E)-8-fluoro-1-N-(2-methoxyethyl)-1-N,3-dimethyl-4-methylidenenona-5,7-diene-1,2-diamine.
| Compound Name | (2S,3S,5Z,7E)-8-fluoro-1-N-(2-methoxyethyl)-1-N,3-dimethyl-4-methylidenenona-5,7-diene-1,2-diamine |
|---|---|
| PubChem CID | 146237710 |
| Molecular Formula | C15H27FN2O |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2S,3S,5Z,7E)-8-fluoro-1-N-(2-methoxyethyl)-1-N,3-dimethyl-4-methylidenenona-5,7-diene-1,2-diamine |
| SMILES | C=C(/C=C\C=C(/C)F)[C@H](C)[C@H](N)CN(C)CCOC |
| InChI | InChI=1S/C15H27FN2O/c1-12(7-6-8-13(2)16)14(3)15(17)11-18(4)9-10-19-5/h6-8,14-15H,1,9-11,17H2,2-5H3/b7-6-,13-8+/t14-,15+/m0/s1 |
| InChIKey | LTLNEZJQGOIMHJ-REYCSXHTSA-N |
| XLogP | 2.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|