About 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine
4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine (PubChem CID 146237735) has the molecular formula C15H17N5
and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine |
| PubChem CID | 146237735 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine |
| SMILES | CC1=NCC(c2nn(-c3ccccc3)c(N)c2C)=CN1 |
| InChI | InChI=1S/C15H17N5/c1-10-14(12-8-17-11(2)18-9-12)19-20(15(10)16)13-6-4-3-5-7-13/h3-8H,9,16H2,1-2H3,(H,17,18) |
| InChIKey | XNNIEKIWPYHFQB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine?
The IUPAC name of 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine (CID 146237735) is 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine.
What is the SMILES notation for 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine?
The canonical SMILES for 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine is CC1=NCC(c2nn(-c3ccccc3)c(N)c2C)=CN1.
What is the InChIKey of 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine?
The InChIKey is XNNIEKIWPYHFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5/c1-10-14(12-8-17-11(2)18-9-12)19-20(15(10)16)13-6-4-3-5-7-13/h3-8H,9,16H2,1-2H3,(H,17,18).
What are the key properties of 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine?
4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine has a molecular weight of 267.34 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(2-methyl-1,4-dihydropyrimidin-5-yl)-1-phenylpyrazol-5-amine is sourced from PubChem (CID 146237735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).