About (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene
(2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene (PubChem CID 146237779) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene.
Molecular Properties
| Compound Name | (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene |
| PubChem CID | 146237779 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene |
| SMILES | CSC(C)(C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H26OS/c1-12(2)8-7-9-13(3)10-11-15-14(4,5)16-6/h8,10H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | XGMQDSRUVQEJTA-JLHYYAGUSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene?
The IUPAC name of (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene (CID 146237779) is (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene.
What is the SMILES notation for (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene?
The canonical SMILES for (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene is CSC(C)(C)OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene?
The InChIKey is XGMQDSRUVQEJTA-JLHYYAGUSA-N. The full InChI is InChI=1S/C14H26OS/c1-12(2)8-7-9-13(3)10-11-15-14(4,5)16-6/h8,10H,7,9,11H2,1-6H3/b13-10+.
What are the key properties of (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene?
(2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene has a molecular weight of 242.43 g/mol, XLogP of 4.79, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethyl-1-(2-methylsulfanylpropan-2-yloxy)octa-2,6-diene is sourced from PubChem (CID 146237779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).