C26H36FN5O2 — CID 146237945
5-[4-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-fluoro-5-hydroxyphenyl]-1-methylpyridin-2-one (PubChem CID 146237945) has the molecular formula C26H36FN5O2 and a molecular weight of 469.61 g/mol. Its IUPAC name is 5-[4-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-fluoro-5-hydroxyphenyl]-1-methylpyridin-2-one.
| Compound Name | 5-[4-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-fluoro-5-hydroxyphenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 146237945 |
| Molecular Formula | C26H36FN5O2 |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 5-[4-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-fluoro-5-hydroxyphenyl]-1-methylpyridin-2-one |
| SMILES | CN(/C(N)=C/C=C(\N)c1c(O)cc(-c2ccc(=O)n(C)c2)cc1F)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H36FN5O2/c1-25(2)13-18(14-26(3,4)30-25)32(6)22(29)9-8-20(28)24-19(27)11-17(12-21(24)33)16-7-10-23(34)31(5)15-16/h7-12,15,18,30,33H,13-14,28-29H2,1-6H3/b20-8-,22-9+ |
| InChIKey | VSAHZFKXVDTSDR-BTIAAVFOSA-N |
| XLogP | 3.24 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|