C20H30O4 — CID 146238399
(3,3,5-trimethylcyclohexyl) 6-(1-hydroxy-2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 146238399) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 6-(1-hydroxy-2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 6-(1-hydroxy-2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 146238399 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 6-(1-hydroxy-2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C)C(O)OC1CC=CC=C1C(=O)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C20H30O4/c1-13(2)18(21)24-17-9-7-6-8-16(17)19(22)23-15-10-14(3)11-20(4,5)12-15/h6-8,14-15,17-18,21H,1,9-12H2,2-5H3 |
| InChIKey | JOONRKMQUQYPEW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|