About 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid
2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 146238765) has the molecular formula C7H11NO2S
and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 146238765 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)C1NC(C(=O)O)=CS1 |
| InChI | InChI=1S/C7H11NO2S/c1-4(2)6-8-5(3-11-6)7(9)10/h3-4,6,8H,1-2H3,(H,9,10) |
| InChIKey | FHGIMWNZLDWOLY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid (CID 146238765) is 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid is CC(C)C1NC(C(=O)O)=CS1.
What is the InChIKey of 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is FHGIMWNZLDWOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S/c1-4(2)6-8-5(3-11-6)7(9)10/h3-4,6,8H,1-2H3,(H,9,10).
What are the key properties of 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid?
2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 173.24 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-2,3-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 146238765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).