C9H16N2 — CID 146238809
(Z)-3-N,2,4-trimethyl-1-N-methylidenepent-1-ene-1,3-diimine (PubChem CID 146238809) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-3-N,2,4-trimethyl-1-N-methylidenepent-1-ene-1,3-diimine.
| Compound Name | (Z)-3-N,2,4-trimethyl-1-N-methylidenepent-1-ene-1,3-diimine |
|---|---|
| PubChem CID | 146238809 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z)-3-N,2,4-trimethyl-1-N-methylidenepent-1-ene-1,3-diimine |
| SMILES | C=N/C=C(C)\C(=N\C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)9(11-5)8(3)6-10-4/h6-7H,4H2,1-3,5H3/b8-6-,11-9+ |
| InChIKey | WMYSGSCESRZADS-ZOEDNYEGSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|