C24H25N3O3 — CID 146239214
methyl 1-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate (PubChem CID 146239214) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 1-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate.
| Compound Name | methyl 1-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 146239214 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methyl 1-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(Cn2nc(C)c3c(C(=O)OC)cc(C)nc32)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-6-8-9-19(7-2)30-20-12-10-18(11-13-20)15-27-23-22(17(4)26-27)21(24(28)29-5)14-16(3)25-23/h6-14H,2,15H2,1,3-5H3/b8-6-,19-9+ |
| InChIKey | FJVMYIZLOJIKEM-WOBUGMMBSA-N |
| XLogP | 4.91 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|