C22H23N3O4 — CID 146239223
[6-(furan-2-yl)-3-methyl-1-(3-phenoxypropyl)pyrazolo[5,4-b]pyridin-4-yl]-methoxymethanol (PubChem CID 146239223) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [6-(furan-2-yl)-3-methyl-1-(3-phenoxypropyl)pyrazolo[5,4-b]pyridin-4-yl]-methoxymethanol.
| Compound Name | [6-(furan-2-yl)-3-methyl-1-(3-phenoxypropyl)pyrazolo[5,4-b]pyridin-4-yl]-methoxymethanol |
|---|---|
| PubChem CID | 146239223 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [6-(furan-2-yl)-3-methyl-1-(3-phenoxypropyl)pyrazolo[5,4-b]pyridin-4-yl]-methoxymethanol |
| SMILES | COC(O)c1cc(-c2ccco2)nc2c1c(C)nn2CCCOc1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c1-15-20-17(22(26)27-2)14-18(19-10-6-12-29-19)23-21(20)25(24-15)11-7-13-28-16-8-4-3-5-9-16/h3-6,8-10,12,14,22,26H,7,11,13H2,1-2H3 |
| InChIKey | JDIVQHUGNMUBGZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|