C10H14FI — CID 146239579
(3Z,5Z)-5-fluoro-6-iodo-2,4-dimethylocta-1,3,5-triene (PubChem CID 146239579) has the molecular formula C10H14FI and a molecular weight of 280.12 g/mol. Its IUPAC name is (3Z,5Z)-5-fluoro-6-iodo-2,4-dimethylocta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-fluoro-6-iodo-2,4-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 146239579 |
| Molecular Formula | C10H14FI |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (3Z,5Z)-5-fluoro-6-iodo-2,4-dimethylocta-1,3,5-triene |
| SMILES | C=C(C)/C=C(C)\C(F)=C(\I)CC |
| InChI | InChI=1S/C10H14FI/c1-5-9(12)10(11)8(4)6-7(2)3/h6H,2,5H2,1,3-4H3/b8-6-,10-9- |
| InChIKey | MYFWZKIKJHGILG-VAOAJWRNSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|