C24H36O8 — CID 146240176
ethyl (E)-3-[(3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-7-hydroxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-yl]prop-2-enoate (PubChem CID 146240176) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is ethyl (E)-3-[(3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-7-hydroxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-7-hydroxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 146240176 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | ethyl (E)-3-[(3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-7-hydroxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1O[C@@H]([C@H]2COC3(CCCCC3)O2)[C@H]2OC3(CCCCC3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C24H36O8/c1-2-27-18(25)10-9-16-19(26)21-22(32-24(31-21)13-7-4-8-14-24)20(29-16)17-15-28-23(30-17)11-5-3-6-12-23/h9-10,16-17,19-22,26H,2-8,11-15H2,1H3/b10-9+/t16-,17+,19-,20-,21-,22+/m0/s1 |
| InChIKey | YOYNBYTUOSLOBB-YSYZNNTJSA-N |
| XLogP | 2.75 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|