C20H32O8 — CID 146240182
ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(1R)-1,2-dihydroxyethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 146240182) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(1R)-1,2-dihydroxyethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(1R)-1,2-dihydroxyethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 146240182 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | ethyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(1R)-1,2-dihydroxyethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@@H]2O[C@@H]([C@H](O)CO)[C@H]3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C20H32O8/c1-2-24-15(23)10-12-6-7-14-17(25-12)19-18(16(26-14)13(22)11-21)27-20(28-19)8-4-3-5-9-20/h12-14,16-19,21-22H,2-11H2,1H3/t12-,13-,14+,16+,17+,18-,19+/m1/s1 |
| InChIKey | ZJUHXWQDWMWQIB-UETVFZEGSA-N |
| XLogP | 1.05 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |