C13H22FNO3 — CID 146240467
tert-butyl 3-fluoro-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 146240467) has the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 146240467 |
| Molecular Formula | C13H22FNO3 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | tert-butyl 3-fluoro-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(F)(CO)C2 |
| InChI | InChI=1S/C13H22FNO3/c1-12(2,3)18-11(17)15-9-4-5-10(15)7-13(14,6-9)8-16/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | CWFVWUXSPZOMIH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |