About 2,5-dihydropyrido[4,3-c]azepin-3-one
2,5-dihydropyrido[4,3-c]azepin-3-one (PubChem CID 146240609) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2,5-dihydropyrido[4,3-c]azepin-3-one.
Molecular Properties
| Compound Name | 2,5-dihydropyrido[4,3-c]azepin-3-one |
| PubChem CID | 146240609 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2,5-dihydropyrido[4,3-c]azepin-3-one |
| SMILES | O=c1cc2c(c[nH]1)C=CC=NC2 |
| InChI | InChI=1S/C9H8N2O/c12-9-4-8-5-10-3-1-2-7(8)6-11-9/h1-4,6H,5H2,(H,11,12) |
| InChIKey | LPJNYDXVDCLXFO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dihydropyrido[4,3-c]azepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydropyrido[4,3-c]azepin-3-one?
The IUPAC name of 2,5-dihydropyrido[4,3-c]azepin-3-one (CID 146240609) is 2,5-dihydropyrido[4,3-c]azepin-3-one.
What is the SMILES notation for 2,5-dihydropyrido[4,3-c]azepin-3-one?
The canonical SMILES for 2,5-dihydropyrido[4,3-c]azepin-3-one is O=c1cc2c(c[nH]1)C=CC=NC2.
What is the InChIKey of 2,5-dihydropyrido[4,3-c]azepin-3-one?
The InChIKey is LPJNYDXVDCLXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9-4-8-5-10-3-1-2-7(8)6-11-9/h1-4,6H,5H2,(H,11,12).
What are the key properties of 2,5-dihydropyrido[4,3-c]azepin-3-one?
2,5-dihydropyrido[4,3-c]azepin-3-one has a molecular weight of 160.18 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydropyrido[4,3-c]azepin-3-one is sourced from PubChem (CID 146240609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).