About 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide
11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide (PubChem CID 146240701) has the molecular formula C13H11N3O2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide.
Molecular Properties
| Compound Name | 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide |
| PubChem CID | 146240701 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide |
| SMILES | NS(=O)(=O)C1=CC=C2C=NC=c3ccncc3=C2C1 |
| InChI | InChI=1S/C13H11N3O2S/c14-19(17,18)11-2-1-9-6-16-7-10-3-4-15-8-13(10)12(9)5-11/h1-4,6-8H,5H2,(H2,14,17,18) |
| InChIKey | QDPFDIGKWDQCSG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide?
The IUPAC name of 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide (CID 146240701) is 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide.
What is the SMILES notation for 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide?
The canonical SMILES for 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide is NS(=O)(=O)C1=CC=C2C=NC=c3ccncc3=C2C1.
What is the InChIKey of 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide?
The InChIKey is QDPFDIGKWDQCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c14-19(17,18)11-2-1-9-6-16-7-10-3-4-15-8-13(10)12(9)5-11/h1-4,6-8H,5H2,(H2,14,17,18).
What are the key properties of 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide?
11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide has a molecular weight of 273.32 g/mol, XLogP of -0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-pyrido[4,3-d][2]benzazepine-10-sulfonamide is sourced from PubChem (CID 146240701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).