C30H29F2N7O2 — CID 146240745
5-[[(1S,5R)-8-(2,2-difluoroethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine (PubChem CID 146240745) has the molecular formula C30H29F2N7O2 and a molecular weight of 557.61 g/mol. Its IUPAC name is 5-[[(1S,5R)-8-(2,2-difluoroethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine.
| Compound Name | 5-[[(1S,5R)-8-(2,2-difluoroethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146240745 |
| Molecular Formula | C30H29F2N7O2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 5-[[(1S,5R)-8-(2,2-difluoroethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3cccc(OC4C[C@H]5CC[C@@H](C4)N5CC(F)F)c23)ccc1Oc1ccn2ncnc2c1 |
| InChI | InChI=1S/C30H29F2N7O2/c1-18-11-19(5-8-25(18)40-22-9-10-39-28(14-22)34-17-36-39)37-30-29-24(33-16-35-30)3-2-4-26(29)41-23-12-20-6-7-21(13-23)38(20)15-27(31)32/h2-5,8-11,14,16-17,20-21,23,27H,6-7,12-13,15H2,1H3,(H,33,35,37)/t20-,21+,23? |
| InChIKey | IJKYTLFDLUSRSJ-TYABSZSSSA-N |
| XLogP | 6.16 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |