About 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine
4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine (PubChem CID 146241232) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 146241232 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(N)CC1 |
| InChI | InChI=1S/C9H15NO2S/c1-7(2)13(11,12)9-5-3-8(10)4-6-9/h3,5,7H,4,6,10H2,1-2H3 |
| InChIKey | GQHQLDVVZZABCW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine (CID 146241232) is 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine is CC(C)S(=O)(=O)C1=CC=C(N)CC1.
What is the InChIKey of 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine?
The InChIKey is GQHQLDVVZZABCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S/c1-7(2)13(11,12)9-5-3-8(10)4-6-9/h3,5,7H,4,6,10H2,1-2H3.
What are the key properties of 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine?
4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine has a molecular weight of 201.29 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylsulfonylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 146241232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).