C19H22F3NO3 — CID 146242394
(2,2,2-trifluoroacetyl) (1S,4aS,10aR)-6-amino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 146242394) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (1S,4aS,10aR)-6-amino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (1S,4aS,10aR)-6-amino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 146242394 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (1S,4aS,10aR)-6-amino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | C[C@]1(C(=O)OC(=O)C(F)(F)F)CCC[C@]2(C)c3cc(N)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C19H22F3NO3/c1-17-8-3-9-18(2,15(24)26-16(25)19(20,21)22)14(17)7-5-11-4-6-12(23)10-13(11)17/h4,6,10,14H,3,5,7-9,23H2,1-2H3/t14-,17-,18+/m1/s1 |
| InChIKey | BMCOZCZFCCLPQD-OLMNPRSZSA-N |
| XLogP | 3.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|