C29H25Cl2F6N3O5S — CID 146242505
3-[3-[4-[2-(2,6-dichlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]sulfonylpropyl-methylcarbamic acid (PubChem CID 146242505) has the molecular formula C29H25Cl2F6N3O5S and a molecular weight of 712.50 g/mol. Its IUPAC name is 3-[3-[4-[2-(2,6-dichlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]sulfonylpropyl-methylcarbamic acid.
| Compound Name | 3-[3-[4-[2-(2,6-dichlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]sulfonylpropyl-methylcarbamic acid |
|---|---|
| PubChem CID | 146242505 |
| Molecular Formula | C29H25Cl2F6N3O5S |
| Molecular Weight | 712.50 g/mol |
| Exact Mass | 711.08 |
| IUPAC Name | 3-[3-[4-[2-(2,6-dichlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]sulfonylpropyl-methylcarbamic acid |
| SMILES | CN(CCCS(=O)(=O)c1cccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3c(Cl)cccc3Cl)cc2)c1)C(=O)O |
| InChI | InChI=1S/C29H25Cl2F6N3O5S/c1-39(26(41)42)13-4-14-46(44,45)20-6-2-5-19(15-20)17-9-11-18(12-10-17)23-16-24(27(43,28(32,33)34)29(35,36)37)38-40(23)25-21(30)7-3-8-22(25)31/h2-3,5-12,15,23,43H,4,13-14,16H2,1H3,(H,41,42) |
| InChIKey | WUGTZVJEODHPAY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.50 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |