About 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one
5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one (PubChem CID 146242976) has the molecular formula C15H17BrFN3O3S
and a molecular weight of 418.29 g/mol. Its IUPAC name is 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one |
| PubChem CID | 146242976 |
| Molecular Formula | C15H17BrFN3O3S |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one |
| SMILES | O=c1c(N2CCS(O)(O)CC2)nc(Br)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H17BrFN3O3S/c16-13-10-20(9-11-1-3-12(17)4-2-11)15(21)14(18-13)19-5-7-24(22,23)8-6-19/h1-4,10,22-23H,5-9H2 |
| InChIKey | LQPBBCUFTHGUSE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one?
The IUPAC name of 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one (CID 146242976) is 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one.
What is the SMILES notation for 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one?
The canonical SMILES for 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one is O=c1c(N2CCS(O)(O)CC2)nc(Br)cn1Cc1ccc(F)cc1.
What is the InChIKey of 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one?
The InChIKey is LQPBBCUFTHGUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrFN3O3S/c16-13-10-20(9-11-1-3-12(17)4-2-11)15(21)14(18-13)19-5-7-24(22,23)8-6-19/h1-4,10,22-23H,5-9H2.
What are the key properties of 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one?
5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one has a molecular weight of 418.29 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one is sourced from PubChem (CID 146242976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).