C23H29FN4O3 — CID 146243073
methyl 1-[5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-2-oxo-1H-pyrazin-3-yl]piperidine-4-carboxylate (PubChem CID 146243073) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 1-[5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-2-oxo-1H-pyrazin-3-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-2-oxo-1H-pyrazin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 146243073 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | methyl 1-[5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-2-oxo-1H-pyrazin-3-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2nc(CCCN[C@@H]3C[C@H]3c3ccc(F)cc3)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C23H29FN4O3/c1-31-23(30)16-8-11-28(12-9-16)21-22(29)26-14-18(27-21)3-2-10-25-20-13-19(20)15-4-6-17(24)7-5-15/h4-7,14,16,19-20,25H,2-3,8-13H2,1H3,(H,26,29)/t19-,20+/m0/s1 |
| InChIKey | ZJRNBOTZBNCADX-VQTJNVASSA-N |
| XLogP | 2.38 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|