C21H28FN5O3S — CID 146243075
5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methylsulfonylpiperazin-1-yl)-1H-pyrazin-2-one (PubChem CID 146243075) has the molecular formula C21H28FN5O3S and a molecular weight of 449.55 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methylsulfonylpiperazin-1-yl)-1H-pyrazin-2-one.
| Compound Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methylsulfonylpiperazin-1-yl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 146243075 |
| Molecular Formula | C21H28FN5O3S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methylsulfonylpiperazin-1-yl)-1H-pyrazin-2-one |
| SMILES | CS(=O)(=O)N1CCN(c2nc(CCCN[C@@H]3C[C@H]3c3ccc(F)cc3)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C21H28FN5O3S/c1-31(29,30)27-11-9-26(10-12-27)20-21(28)24-14-17(25-20)3-2-8-23-19-13-18(19)15-4-6-16(22)7-5-15/h4-7,14,18-19,23H,2-3,8-13H2,1H3,(H,24,28)/t18-,19+/m0/s1 |
| InChIKey | GPWGOYWMAXOVJF-RBUKOAKNSA-N |
| XLogP | 1.07 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|