C14H12Cl3F5N4 — CID 14624371
N,N-diethyl-5-(1,1,2,2,2-pentafluoroethyl)-2-(2,4,6-trichlorophenyl)-1,2,4-triazol-3-amine (PubChem CID 14624371) has the molecular formula C14H12Cl3F5N4 and a molecular weight of 437.63 g/mol. Its IUPAC name is N,N-diethyl-5-(1,1,2,2,2-pentafluoroethyl)-2-(2,4,6-trichlorophenyl)-1,2,4-triazol-3-amine.
| Compound Name | N,N-diethyl-5-(1,1,2,2,2-pentafluoroethyl)-2-(2,4,6-trichlorophenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 14624371 |
| Molecular Formula | C14H12Cl3F5N4 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | N,N-diethyl-5-(1,1,2,2,2-pentafluoroethyl)-2-(2,4,6-trichlorophenyl)-1,2,4-triazol-3-amine |
| SMILES | CCN(CC)c1nc(C(F)(F)C(F)(F)F)nn1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl3F5N4/c1-3-25(4-2)12-23-11(13(18,19)14(20,21)22)24-26(12)10-8(16)5-7(15)6-9(10)17/h5-6H,3-4H2,1-2H3 |
| InChIKey | KGMGUHRVLRJBGL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|