C29H60N2 — CID 146243904
4-ethyl-2-N,12-N,3,5,9,11,13-heptamethyl-12-N-(3-methylbutyl)pentadec-1-ene-2,12-diamine (PubChem CID 146243904) has the molecular formula C29H60N2 and a molecular weight of 436.81 g/mol. Its IUPAC name is 4-ethyl-2-N,12-N,3,5,9,11,13-heptamethyl-12-N-(3-methylbutyl)pentadec-1-ene-2,12-diamine.
| Compound Name | 4-ethyl-2-N,12-N,3,5,9,11,13-heptamethyl-12-N-(3-methylbutyl)pentadec-1-ene-2,12-diamine |
|---|---|
| PubChem CID | 146243904 |
| Molecular Formula | C29H60N2 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.48 |
| IUPAC Name | 4-ethyl-2-N,12-N,3,5,9,11,13-heptamethyl-12-N-(3-methylbutyl)pentadec-1-ene-2,12-diamine |
| SMILES | C=C(NC)C(C)C(CC)C(C)CCCC(C)CC(C)C(C(C)CC)N(C)CCC(C)C |
| InChI | InChI=1S/C29H60N2/c1-13-23(6)29(31(12)19-18-21(3)4)25(8)20-22(5)16-15-17-24(7)28(14-2)26(9)27(10)30-11/h21-26,28-30H,10,13-20H2,1-9,11-12H3 |
| InChIKey | XTJFYYPWIYXEQI-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |