About N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide
N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide (PubChem CID 146244019) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide |
| PubChem CID | 146244019 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide |
| SMILES | C/N=C(C)/N=C/CC(C)(C)n1cnc2c1=CCCC=2 |
| InChI | InChI=1S/C15H22N4/c1-12(16-4)17-10-9-15(2,3)19-11-18-13-7-5-6-8-14(13)19/h7-8,10-11H,5-6,9H2,1-4H3/b16-12+,17-10+ |
| InChIKey | FIMMSSXETPOXGU-VMHPKHSQSA-N |
| XLogP | 1.48 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide?
The IUPAC name of N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide (CID 146244019) is N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide.
What is the SMILES notation for N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide?
The canonical SMILES for N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide is C/N=C(C)/N=C/CC(C)(C)n1cnc2c1=CCCC=2.
What is the InChIKey of N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide?
The InChIKey is FIMMSSXETPOXGU-VMHPKHSQSA-N. The full InChI is InChI=1S/C15H22N4/c1-12(16-4)17-10-9-15(2,3)19-11-18-13-7-5-6-8-14(13)19/h7-8,10-11H,5-6,9H2,1-4H3/b16-12+,17-10+.
What are the key properties of N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide?
N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide has a molecular weight of 258.37 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5,6-dihydrobenzimidazol-1-yl)-3-methylbutylidene]-N'-methylethanimidamide is sourced from PubChem (CID 146244019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).