About [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane
[2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane (PubChem CID 146244314) has the molecular formula C15H27OP
and a molecular weight of 254.35 g/mol. Its IUPAC name is [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane.
Molecular Properties
| Compound Name | [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane |
| PubChem CID | 146244314 |
| Molecular Formula | C15H27OP |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane |
| SMILES | C=PC1CCCCC1[C@@]1(C)CCCC[C@H]1OC |
| InChI | InChI=1S/C15H27OP/c1-15(11-7-6-10-14(15)16-2)12-8-4-5-9-13(12)17-3/h12-14H,3-11H2,1-2H3/t12?,13?,14-,15-/m1/s1 |
| InChIKey | CXGJSNPXVYOERN-NEXFUWMNSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane?
The IUPAC name of [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane (CID 146244314) is [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane.
What is the SMILES notation for [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane?
The canonical SMILES for [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane is C=PC1CCCCC1[C@@]1(C)CCCC[C@H]1OC.
What is the InChIKey of [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane?
The InChIKey is CXGJSNPXVYOERN-NEXFUWMNSA-N. The full InChI is InChI=1S/C15H27OP/c1-15(11-7-6-10-14(15)16-2)12-8-4-5-9-13(12)17-3/h12-14H,3-11H2,1-2H3/t12?,13?,14-,15-/m1/s1.
What are the key properties of [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane?
[2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane has a molecular weight of 254.35 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1R,2R)-2-methoxy-1-methylcyclohexyl]cyclohexyl]-methylidenephosphane is sourced from PubChem (CID 146244314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).