C27H27Cl2N3O4 — CID 146244971
N-[[1-[[3-(3,5-dichlorophenyl)-5-(4-nitrophenoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide (PubChem CID 146244971) has the molecular formula C27H27Cl2N3O4 and a molecular weight of 528.44 g/mol. Its IUPAC name is N-[[1-[[3-(3,5-dichlorophenyl)-5-(4-nitrophenoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[[3-(3,5-dichlorophenyl)-5-(4-nitrophenoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 146244971 |
| Molecular Formula | C27H27Cl2N3O4 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-[[1-[[3-(3,5-dichlorophenyl)-5-(4-nitrophenoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(Cc2cc(Oc3ccc([N+](=O)[O-])cc3)cc(-c3cc(Cl)cc(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C27H27Cl2N3O4/c1-18(33)30-16-19-6-8-31(9-7-19)17-20-10-21(22-12-23(28)15-24(29)13-22)14-27(11-20)36-26-4-2-25(3-5-26)32(34)35/h2-5,10-15,19H,6-9,16-17H2,1H3,(H,30,33) |
| InChIKey | UTNZIQZEWLWBSQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|