About 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine
3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 146245019) has the molecular formula C15H24N4
and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine |
| PubChem CID | 146245019 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CCCCCCC(CC)c1c(N)nn2cccnc12 |
| InChI | InChI=1S/C15H24N4/c1-3-5-6-7-9-12(4-2)13-14(16)18-19-11-8-10-17-15(13)19/h8,10-12H,3-7,9H2,1-2H3,(H2,16,18) |
| InChIKey | PHRHCULXNGVNSZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine (CID 146245019) is 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine is CCCCCCC(CC)c1c(N)nn2cccnc12.
What is the InChIKey of 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is PHRHCULXNGVNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4/c1-3-5-6-7-9-12(4-2)13-14(16)18-19-11-8-10-17-15(13)19/h8,10-12H,3-7,9H2,1-2H3,(H2,16,18).
What are the key properties of 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 260.38 g/mol, XLogP of 3.78, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonan-3-ylpyrazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 146245019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).