C16H20O6 — CID 146245104
[(3S,4R,5S)-6-methyl-4-(2-oxobut-3-enyl)-5-prop-2-enoyloxyoxan-3-yl] prop-2-enoate (PubChem CID 146245104) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is [(3S,4R,5S)-6-methyl-4-(2-oxobut-3-enyl)-5-prop-2-enoyloxyoxan-3-yl] prop-2-enoate.
| Compound Name | [(3S,4R,5S)-6-methyl-4-(2-oxobut-3-enyl)-5-prop-2-enoyloxyoxan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 146245104 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(3S,4R,5S)-6-methyl-4-(2-oxobut-3-enyl)-5-prop-2-enoyloxyoxan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)C[C@H]1[C@H](OC(=O)C=C)C(C)OC[C@H]1OC(=O)C=C |
| InChI | InChI=1S/C16H20O6/c1-5-11(17)8-12-13(21-14(18)6-2)9-20-10(4)16(12)22-15(19)7-3/h5-7,10,12-13,16H,1-3,8-9H2,4H3/t10?,12-,13-,16-/m1/s1 |
| InChIKey | WZJHJJONHPRLKJ-MJRKIIJRSA-N |
| XLogP | 1.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|