C14H22F3N — CID 146245224
(4E,6E)-N,3-dimethyl-8-methylidene-7-(trifluoromethyl)deca-4,6-dien-4-amine (PubChem CID 146245224) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is (4E,6E)-N,3-dimethyl-8-methylidene-7-(trifluoromethyl)deca-4,6-dien-4-amine.
| Compound Name | (4E,6E)-N,3-dimethyl-8-methylidene-7-(trifluoromethyl)deca-4,6-dien-4-amine |
|---|---|
| PubChem CID | 146245224 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4E,6E)-N,3-dimethyl-8-methylidene-7-(trifluoromethyl)deca-4,6-dien-4-amine |
| SMILES | C=C(CC)/C(=C\C=C(\NC)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C14H22F3N/c1-6-10(3)12(14(15,16)17)8-9-13(18-5)11(4)7-2/h8-9,11,18H,3,6-7H2,1-2,4-5H3/b12-8+,13-9+ |
| InChIKey | GJKYKKXCWYQPGB-QHKWOANTSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|