About (Z)-2-imino-3,4-dimethylnon-3-en-5-one
(Z)-2-imino-3,4-dimethylnon-3-en-5-one (PubChem CID 146245342) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (Z)-2-imino-3,4-dimethylnon-3-en-5-one.
Molecular Properties
| Compound Name | (Z)-2-imino-3,4-dimethylnon-3-en-5-one |
| PubChem CID | 146245342 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (Z)-2-imino-3,4-dimethylnon-3-en-5-one |
| SMILES | [H]/N=C(C)/C(C)=C(/C)C(=O)CCCC |
| InChI | InChI=1S/C11H19NO/c1-5-6-7-11(13)9(3)8(2)10(4)12/h12H,5-7H2,1-4H3/b9-8-,12-10+ |
| InChIKey | DYEXMFWVSFOQLD-LVQHWDRTSA-N |
| XLogP | 3.12 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-imino-3,4-dimethylnon-3-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-imino-3,4-dimethylnon-3-en-5-one?
The IUPAC name of (Z)-2-imino-3,4-dimethylnon-3-en-5-one (CID 146245342) is (Z)-2-imino-3,4-dimethylnon-3-en-5-one.
What is the SMILES notation for (Z)-2-imino-3,4-dimethylnon-3-en-5-one?
The canonical SMILES for (Z)-2-imino-3,4-dimethylnon-3-en-5-one is [H]/N=C(C)/C(C)=C(/C)C(=O)CCCC.
What is the InChIKey of (Z)-2-imino-3,4-dimethylnon-3-en-5-one?
The InChIKey is DYEXMFWVSFOQLD-LVQHWDRTSA-N. The full InChI is InChI=1S/C11H19NO/c1-5-6-7-11(13)9(3)8(2)10(4)12/h12H,5-7H2,1-4H3/b9-8-,12-10+.
What are the key properties of (Z)-2-imino-3,4-dimethylnon-3-en-5-one?
(Z)-2-imino-3,4-dimethylnon-3-en-5-one has a molecular weight of 181.28 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-imino-3,4-dimethylnon-3-en-5-one is sourced from PubChem (CID 146245342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).